C30H54O6 — CID 92522910
1-O,2-O-bis[(2S)-2-ethylhexyl] 3-O-[(2R)-2-ethylhexyl] (Z)-prop-1-ene-1,2,3-tricarboxylate (PubChem CID 92522910) has the molecular formula C30H54O6 and a molecular weight of 510.76 g/mol. Its IUPAC name is 1-O,2-O-bis[(2S)-2-ethylhexyl] 3-O-[(2R)-2-ethylhexyl] (Z)-prop-1-ene-1,2,3-tricarboxylate.
| Compound Name | 1-O,2-O-bis[(2S)-2-ethylhexyl] 3-O-[(2R)-2-ethylhexyl] (Z)-prop-1-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 92522910 |
| Molecular Formula | C30H54O6 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.39 |
| IUPAC Name | 1-O,2-O-bis[(2S)-2-ethylhexyl] 3-O-[(2R)-2-ethylhexyl] (Z)-prop-1-ene-1,2,3-tricarboxylate |
| SMILES | CCCCC(CC)COC(=O)/C=C(/CC(=O)OC[C@H](CC)CCCC)C(=O)OC[C@@H](CC)CCCC |
| InChI | InChI=1S/C30H54O6/c1-7-13-16-24(10-4)21-34-28(31)19-27(30(33)36-23-26(12-6)18-15-9-3)20-29(32)35-22-25(11-5)17-14-8-2/h19,24-26H,7-18,20-23H2,1-6H3/b27-19-/t24?,25-,26+/m1/s1 |
| InChIKey | IVYUYETVYAUBDU-MLWNDQKTSA-N |
| XLogP | 7.58 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|