C24H42O6 — CID 6373092
tris(2-ethylbutyl) (Z)-prop-1-ene-1,2,3-tricarboxylate (PubChem CID 6373092) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is tris(2-ethylbutyl) (Z)-prop-1-ene-1,2,3-tricarboxylate.
| Compound Name | tris(2-ethylbutyl) (Z)-prop-1-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 6373092 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | tris(2-ethylbutyl) (Z)-prop-1-ene-1,2,3-tricarboxylate |
| SMILES | CCC(CC)COC(=O)/C=C(/CC(=O)OCC(CC)CC)C(=O)OCC(CC)CC |
| InChI | InChI=1S/C24H42O6/c1-7-18(8-2)15-28-22(25)13-21(24(27)30-17-20(11-5)12-6)14-23(26)29-16-19(9-3)10-4/h13,18-20H,7-12,14-17H2,1-6H3/b21-13- |
| InChIKey | TYCAEUFHSJDSES-BKUYFWCQSA-N |
| XLogP | 5.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|