C15H20N2O5 — CID 146177819
(2-methyl-1,3-dioxolan-4-yl)methyl (2E,4E)-2-cyano-5-morpholin-4-ylpenta-2,4-dienoate (PubChem CID 146177819) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is (2-methyl-1,3-dioxolan-4-yl)methyl (2E,4E)-2-cyano-5-morpholin-4-ylpenta-2,4-dienoate.
| Compound Name | (2-methyl-1,3-dioxolan-4-yl)methyl (2E,4E)-2-cyano-5-morpholin-4-ylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 146177819 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (2-methyl-1,3-dioxolan-4-yl)methyl (2E,4E)-2-cyano-5-morpholin-4-ylpenta-2,4-dienoate |
| SMILES | CC1OCC(COC(=O)/C(C#N)=C/C=C/N2CCOCC2)O1 |
| InChI | InChI=1S/C15H20N2O5/c1-12-20-10-14(22-12)11-21-15(18)13(9-16)3-2-4-17-5-7-19-8-6-17/h2-4,12,14H,5-8,10-11H2,1H3/b4-2+,13-3+ |
| InChIKey | JSRSIAYOUKHHPK-ZKBHREQGSA-N |
| XLogP | 0.59 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|