C11H14N2O — CID 12621934
(2Z,4E)-2-formyl-5-piperidin-1-ylpenta-2,4-dienenitrile (PubChem CID 12621934) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (2Z,4E)-2-formyl-5-piperidin-1-ylpenta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-2-formyl-5-piperidin-1-ylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 12621934 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (2Z,4E)-2-formyl-5-piperidin-1-ylpenta-2,4-dienenitrile |
| SMILES | N#C/C(C=O)=C/C=C/N1CCCCC1 |
| InChI | InChI=1S/C11H14N2O/c12-9-11(10-14)5-4-8-13-6-2-1-3-7-13/h4-5,8,10H,1-3,6-7H2/b8-4+,11-5- |
| InChIKey | KTYNZNFKXQQHST-XEJYMXSFSA-N |
| XLogP | 1.63 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|