C18H31ClN2 — CID 6434856
1-[(1E,3E)-5-(azepan-1-ium-1-ylidene)-4-methylpenta-1,3-dienyl]azepane chloride (PubChem CID 6434856) has the molecular formula C18H31ClN2 and a molecular weight of 310.91 g/mol. Its IUPAC name is 1-[(1E,3E)-5-(azepan-1-ium-1-ylidene)-4-methylpenta-1,3-dienyl]azepane chloride.
| Compound Name | 1-[(1E,3E)-5-(azepan-1-ium-1-ylidene)-4-methylpenta-1,3-dienyl]azepane chloride |
|---|---|
| PubChem CID | 6434856 |
| Molecular Formula | C18H31ClN2 |
| Molecular Weight | 310.91 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 1-[(1E,3E)-5-(azepan-1-ium-1-ylidene)-4-methylpenta-1,3-dienyl]azepane chloride |
| SMILES | C/C(C=[N+]1CCCCCC1)=C\C=C\N1CCCCCC1.[Cl-] |
| InChI | InChI=1S/C18H31N2.ClH/c1-18(17-20-14-8-4-5-9-15-20)11-10-16-19-12-6-2-3-7-13-19;/h10-11,16-17H,2-9,12-15H2,1H3;1H/q+1;/p-1 |
| InChIKey | DLCYDUCHUVPZDO-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.91 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|