C10H14F3N2O4+ — CID 177070727
(Z)-[1-ethoxy-5-hydroxy-1,3-dioxo-5-(trifluoromethyl)heptan-2-ylidene]-iminoazanium (PubChem CID 177070727) has the molecular formula C10H14F3N2O4+ and a molecular weight of 283.23 g/mol. Its IUPAC name is (Z)-[1-ethoxy-5-hydroxy-1,3-dioxo-5-(trifluoromethyl)heptan-2-ylidene]-iminoazanium.
| Compound Name | (Z)-[1-ethoxy-5-hydroxy-1,3-dioxo-5-(trifluoromethyl)heptan-2-ylidene]-iminoazanium |
|---|---|
| PubChem CID | 177070727 |
| Molecular Formula | C10H14F3N2O4+ |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (Z)-[1-ethoxy-5-hydroxy-1,3-dioxo-5-(trifluoromethyl)heptan-2-ylidene]-iminoazanium |
| SMILES | CCOC(=O)C(=[N+]=N)C(=O)CC(O)(CC)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N2O4/c1-3-9(18,10(11,12)13)5-6(16)7(15-14)8(17)19-4-2/h14,18H,3-5H2,1-2H3/q+1 |
| InChIKey | ZDYPSWKBVPVSQB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|