C7H8N3O3S+ — CID 20833315
(E)-(1-ethoxy-1,3-dioxo-4-thiocyanatobutan-2-ylidene)-iminoazanium (PubChem CID 20833315) has the molecular formula C7H8N3O3S+ and a molecular weight of 214.23 g/mol. Its IUPAC name is (E)-(1-ethoxy-1,3-dioxo-4-thiocyanatobutan-2-ylidene)-iminoazanium.
| Compound Name | (E)-(1-ethoxy-1,3-dioxo-4-thiocyanatobutan-2-ylidene)-iminoazanium |
|---|---|
| PubChem CID | 20833315 |
| Molecular Formula | C7H8N3O3S+ |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | (E)-(1-ethoxy-1,3-dioxo-4-thiocyanatobutan-2-ylidene)-iminoazanium |
| SMILES | CCOC(=O)C(=[N+]=N)C(=O)CSC#N |
| InChI | InChI=1S/C7H8N3O3S/c1-2-13-7(12)6(10-9)5(11)3-14-4-8/h9H,2-3H2,1H3/q+1 |
| InChIKey | PFIFFCLNVVUKKR-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|