C16H22N3O5+ — CID 20831965
(E)-[1-ethoxy-4-(1-hydroxy-5,6-dimethyl-3-oxo-3a,4,7,7a-tetrahydro-1H-isoindol-2-yl)-1,3-dioxobutan-2-ylidene]-iminoazanium (PubChem CID 20831965) has the molecular formula C16H22N3O5+ and a molecular weight of 336.37 g/mol. Its IUPAC name is (E)-[1-ethoxy-4-(1-hydroxy-5,6-dimethyl-3-oxo-3a,4,7,7a-tetrahydro-1H-isoindol-2-yl)-1,3-dioxobutan-2-ylidene]-iminoazanium.
| Compound Name | (E)-[1-ethoxy-4-(1-hydroxy-5,6-dimethyl-3-oxo-3a,4,7,7a-tetrahydro-1H-isoindol-2-yl)-1,3-dioxobutan-2-ylidene]-iminoazanium |
|---|---|
| PubChem CID | 20831965 |
| Molecular Formula | C16H22N3O5+ |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (E)-[1-ethoxy-4-(1-hydroxy-5,6-dimethyl-3-oxo-3a,4,7,7a-tetrahydro-1H-isoindol-2-yl)-1,3-dioxobutan-2-ylidene]-iminoazanium |
| SMILES | CCOC(=O)C(=[N+]=N)C(=O)CN1C(=O)C2CC(C)=C(C)CC2C1O |
| InChI | InChI=1S/C16H22N3O5/c1-4-24-16(23)13(18-17)12(20)7-19-14(21)10-5-8(2)9(3)6-11(10)15(19)22/h10-11,14,17,21H,4-7H2,1-3H3/q+1 |
| InChIKey | GANDNJYYVGRUGG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|