5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester

C10H15NO3 — CID 59789428

IUPACethyl 5-oxo-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate
SMILESCCOC(=O)N1CC2CC(=O)CC2C1
InChIInChI=1S/C10H15NO3/c1-2-14-10(13)11-5-7-3-9(12)4-8(7)6-11/h7-8H,2-6H2,1H3
InChIKeyDIEGYGAAARSLDF-UHFFFAOYSA-N
MW197.23 g/mol
LogP0.20
Rot. Bonds2

About 5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester

5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester (PubChem CID 59789428) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is ethyl 5-oxo-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.

Molecular Properties

Compound Name5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester
PubChem CID59789428
Molecular FormulaC10H15NO3
Molecular Weight197.23 g/mol
Exact Mass197.11
IUPAC Nameethyl 5-oxo-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate
SMILESCCOC(=O)N1CC2CC(=O)CC2C1
InChIInChI=1S/C10H15NO3/c1-2-14-10(13)11-5-7-3-9(12)4-8(7)6-11/h7-8H,2-6H2,1H3
InChIKeyDIEGYGAAARSLDF-UHFFFAOYSA-N
XLogP0.20
TPSA46.60 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity248

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.23
LogP ≤ 50.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester?
The IUPAC name of 5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester (CID 59789428) is ethyl 5-oxo-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
What is the SMILES notation for 5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester?
The canonical SMILES for 5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester is CCOC(=O)N1CC2CC(=O)CC2C1.
What is the InChIKey of 5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester?
The InChIKey is DIEGYGAAARSLDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-2-14-10(13)11-5-7-3-9(12)4-8(7)6-11/h7-8H,2-6H2,1H3.
What are the key properties of 5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester?
5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester has a molecular weight of 197.23 g/mol, XLogP of 0.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-Oxo-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid ethyl ester is sourced from PubChem (CID 59789428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).