C10H12N4O6+2 — CID 20832015
(E)-imino-[1-[2-[(2E)-2-iminoazaniumylidene-3-oxobutanoyl]oxyethoxy]-1,3-dioxobutan-2-ylidene]azanium (PubChem CID 20832015) has the molecular formula C10H12N4O6+2 and a molecular weight of 284.23 g/mol. Its IUPAC name is (E)-imino-[1-[2-[(2E)-2-iminoazaniumylidene-3-oxobutanoyl]oxyethoxy]-1,3-dioxobutan-2-ylidene]azanium.
| Compound Name | (E)-imino-[1-[2-[(2E)-2-iminoazaniumylidene-3-oxobutanoyl]oxyethoxy]-1,3-dioxobutan-2-ylidene]azanium |
|---|---|
| PubChem CID | 20832015 |
| Molecular Formula | C10H12N4O6+2 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (E)-imino-[1-[2-[(2E)-2-iminoazaniumylidene-3-oxobutanoyl]oxyethoxy]-1,3-dioxobutan-2-ylidene]azanium |
| SMILES | CC(=O)C(=[N+]=N)C(=O)OCCOC(=O)C(=[N+]=N)C(C)=O |
| InChI | InChI=1S/C10H12N4O6/c1-5(15)7(13-11)9(17)19-3-4-20-10(18)8(14-12)6(2)16/h11-12H,3-4H2,1-2H3/q+2 |
| InChIKey | TTYNLCNIWIKCDK-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 162.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|