About 3-chloropropyl 2-oxopropanoate
3-chloropropyl 2-oxopropanoate (PubChem CID 55302945) has the molecular formula C6H9ClO3
and a molecular weight of 164.59 g/mol. Its IUPAC name is 3-chloropropyl 2-oxopropanoate.
Molecular Properties
| Compound Name | 3-chloropropyl 2-oxopropanoate |
| PubChem CID | 55302945 |
| Molecular Formula | C6H9ClO3 |
| Molecular Weight | 164.59 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 3-chloropropyl 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OCCCCl |
| InChI | InChI=1S/C6H9ClO3/c1-5(8)6(9)10-4-2-3-7/h2-4H2,1H3 |
| InChIKey | ILJMFIXBAPNBNE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.59 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropyl 2-oxopropanoate?
The IUPAC name of 3-chloropropyl 2-oxopropanoate (CID 55302945) is 3-chloropropyl 2-oxopropanoate.
What is the SMILES notation for 3-chloropropyl 2-oxopropanoate?
The canonical SMILES for 3-chloropropyl 2-oxopropanoate is CC(=O)C(=O)OCCCCl.
What is the InChIKey of 3-chloropropyl 2-oxopropanoate?
The InChIKey is ILJMFIXBAPNBNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO3/c1-5(8)6(9)10-4-2-3-7/h2-4H2,1H3.
What are the key properties of 3-chloropropyl 2-oxopropanoate?
3-chloropropyl 2-oxopropanoate has a molecular weight of 164.59 g/mol, XLogP of 0.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropyl 2-oxopropanoate is sourced from PubChem (CID 55302945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).