C9H19O4- — CID 158133610
1,3-diethoxy-3-oxoprop-1-en-1-olate;methane (PubChem CID 158133610) has the molecular formula C9H19O4- and a molecular weight of 191.25 g/mol. Its IUPAC name is 1,3-diethoxy-3-oxoprop-1-en-1-olate;methane.
| Compound Name | 1,3-diethoxy-3-oxoprop-1-en-1-olate;methane |
|---|---|
| PubChem CID | 158133610 |
| Molecular Formula | C9H19O4- |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 1,3-diethoxy-3-oxoprop-1-en-1-olate;methane |
| SMILES | C.C.CCOC(=O)C=C([O-])OCC |
| InChI | InChI=1S/C7H12O4.2CH4/c1-3-10-6(8)5-7(9)11-4-2;;/h5,8H,3-4H2,1-2H3;2*1H4/p-1 |
| InChIKey | IXNNVOUOZMOVGE-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|