C19H21F4NO — CID 98328149
(3R,5R)-3,5-dimethyl-N-(2,3,5,6-tetrafluorophenyl)adamantane-1-carboxamide (PubChem CID 98328149) has the molecular formula C19H21F4NO and a molecular weight of 355.38 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethyl-N-(2,3,5,6-tetrafluorophenyl)adamantane-1-carboxamide.
| Compound Name | (3R,5R)-3,5-dimethyl-N-(2,3,5,6-tetrafluorophenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98328149 |
| Molecular Formula | C19H21F4NO |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (3R,5R)-3,5-dimethyl-N-(2,3,5,6-tetrafluorophenyl)adamantane-1-carboxamide |
| SMILES | C[C@]12CC3CC(C(=O)Nc4c(F)c(F)cc(F)c4F)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C19H21F4NO/c1-17-4-10-5-18(2,7-17)9-19(6-10,8-17)16(25)24-15-13(22)11(20)3-12(21)14(15)23/h3,10H,4-9H2,1-2H3,(H,24,25)/t10?,17-,18-,19?/m1/s1 |
| InChIKey | CLEOFNJQYFEPDU-RKLQTORHSA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|