C21H29NO — CID 112759840
3,5-dimethyl-N-(1-phenylethyl)adamantane-1-carboxamide (PubChem CID 112759840) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 3,5-dimethyl-N-(1-phenylethyl)adamantane-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-(1-phenylethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 112759840 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 3,5-dimethyl-N-(1-phenylethyl)adamantane-1-carboxamide |
| SMILES | CC(NC(=O)C12CC3CC(C)(CC(C)(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C21H29NO/c1-15(17-7-5-4-6-8-17)22-18(23)21-11-16-9-19(2,13-21)12-20(3,10-16)14-21/h4-8,15-16H,9-14H2,1-3H3,(H,22,23) |
| InChIKey | LIJBVSPWQMIUAT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |