C13H15Br2NO — CID 3109732
2,2-dibromo-1-methyl-N-(1-phenylethyl)cyclopropane-1-carboxamide (PubChem CID 3109732) has the molecular formula C13H15Br2NO and a molecular weight of 361.08 g/mol. Its IUPAC name is 2,2-dibromo-1-methyl-N-(1-phenylethyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dibromo-1-methyl-N-(1-phenylethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3109732 |
| Molecular Formula | C13H15Br2NO |
| Molecular Weight | 361.08 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 2,2-dibromo-1-methyl-N-(1-phenylethyl)cyclopropane-1-carboxamide |
| SMILES | CC(NC(=O)C1(C)CC1(Br)Br)c1ccccc1 |
| InChI | InChI=1S/C13H15Br2NO/c1-9(10-6-4-3-5-7-10)16-11(17)12(2)8-13(12,14)15/h3-7,9H,8H2,1-2H3,(H,16,17) |
| InChIKey | IDVKVUZYDPROIM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.08 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|