C23H31NO3 — CID 164674090
methyl (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-phenylpropanoate (PubChem CID 164674090) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is methyl (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 164674090 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | methyl (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C23H31NO3/c1-21-10-17-11-22(2,13-21)15-23(12-17,14-21)20(26)24-18(19(25)27-3)9-16-7-5-4-6-8-16/h4-8,17-18H,9-15H2,1-3H3,(H,24,26)/t17?,18-,21?,22?,23?/m1/s1 |
| InChIKey | PQYAJZDFSBCALA-ITNDEGMYSA-N |
| XLogP | 3.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |