C29H43FN4O4 — CID 175800933
4-[[(3R,5S)-3,5-dimethyl-1-adamantyl]carbamoylamino]-3-fluoro-N-[9-(hydroxyamino)-9-oxononyl]benzamide (PubChem CID 175800933) has the molecular formula C29H43FN4O4 and a molecular weight of 530.69 g/mol. Its IUPAC name is 4-[[(3R,5S)-3,5-dimethyl-1-adamantyl]carbamoylamino]-3-fluoro-N-[9-(hydroxyamino)-9-oxononyl]benzamide.
| Compound Name | 4-[[(3R,5S)-3,5-dimethyl-1-adamantyl]carbamoylamino]-3-fluoro-N-[9-(hydroxyamino)-9-oxononyl]benzamide |
|---|---|
| PubChem CID | 175800933 |
| Molecular Formula | C29H43FN4O4 |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | 4-[[(3R,5S)-3,5-dimethyl-1-adamantyl]carbamoylamino]-3-fluoro-N-[9-(hydroxyamino)-9-oxononyl]benzamide |
| SMILES | C[C@]12CC3CC(NC(=O)Nc4ccc(C(=O)NCCCCCCCCC(=O)NO)cc4F)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C29H43FN4O4/c1-27-14-20-15-28(2,17-27)19-29(16-20,18-27)33-26(37)32-23-11-10-21(13-22(23)30)25(36)31-12-8-6-4-3-5-7-9-24(35)34-38/h10-11,13,20,38H,3-9,12,14-19H2,1-2H3,(H,31,36)(H,34,35)(H2,32,33,37)/t20?,27-,28+,29? |
| InChIKey | PFVBRAJMESGKCB-ZOLHVZMQSA-N |
| XLogP | 5.66 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|