C28H31FN4O3S — CID 166062773
4-(benzhydrylcarbamothioylamino)-3-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (PubChem CID 166062773) has the molecular formula C28H31FN4O3S and a molecular weight of 522.65 g/mol. Its IUPAC name is 4-(benzhydrylcarbamothioylamino)-3-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide.
| Compound Name | 4-(benzhydrylcarbamothioylamino)-3-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
|---|---|
| PubChem CID | 166062773 |
| Molecular Formula | C28H31FN4O3S |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 4-(benzhydrylcarbamothioylamino)-3-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
| SMILES | O=C(CCCCCCNC(=O)c1ccc(NC(=S)NC(c2ccccc2)c2ccccc2)c(F)c1)NO |
| InChI | InChI=1S/C28H31FN4O3S/c29-23-19-22(27(35)30-18-10-2-1-9-15-25(34)33-36)16-17-24(23)31-28(37)32-26(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-8,11-14,16-17,19,26,36H,1-2,9-10,15,18H2,(H,30,35)(H,33,34)(H2,31,32,37) |
| InChIKey | NHSBWUVOFZHKON-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|