C22H24F4N4O4S — CID 166062775
3-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]benzamide (PubChem CID 166062775) has the molecular formula C22H24F4N4O4S and a molecular weight of 516.52 g/mol. Its IUPAC name is 3-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]benzamide.
| Compound Name | 3-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 166062775 |
| Molecular Formula | C22H24F4N4O4S |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 3-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]benzamide |
| SMILES | O=C(CCCCCCNC(=O)c1ccc(NC(=S)Nc2ccc(OC(F)(F)F)cc2)c(F)c1)NO |
| InChI | InChI=1S/C22H24F4N4O4S/c23-17-13-14(20(32)27-12-4-2-1-3-5-19(31)30-33)6-11-18(17)29-21(35)28-15-7-9-16(10-8-15)34-22(24,25)26/h6-11,13,33H,1-5,12H2,(H,27,32)(H,30,31)(H2,28,29,35) |
| InChIKey | NVOIZHYOELSREN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|