C20H24N4O2S — CID 162662972
6-[(benzhydrylideneamino)carbamothioylamino]-N-hydroxyhexanamide (PubChem CID 162662972) has the molecular formula C20H24N4O2S and a molecular weight of 384.50 g/mol. Its IUPAC name is 6-[(benzhydrylideneamino)carbamothioylamino]-N-hydroxyhexanamide.
| Compound Name | 6-[(benzhydrylideneamino)carbamothioylamino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 162662972 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 6-[(benzhydrylideneamino)carbamothioylamino]-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCNC(=S)NN=C(c1ccccc1)c1ccccc1)NO |
| InChI | InChI=1S/C20H24N4O2S/c25-18(24-26)14-8-3-9-15-21-20(27)23-22-19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-2,4-7,10-13,26H,3,8-9,14-15H2,(H,24,25)(H2,21,23,27) |
| InChIKey | WTCBXXBYYXKATB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|