C39H52Cl2N6S2 — CID 127049225
1-benzhydryl-3-[3-[5-[3-(benzhydrylcarbamothioylamino)propylamino]pentylamino]propyl]thiourea;dihydrochloride (PubChem CID 127049225) has the molecular formula C39H52Cl2N6S2 and a molecular weight of 739.93 g/mol. Its IUPAC name is 1-benzhydryl-3-[3-[5-[3-(benzhydrylcarbamothioylamino)propylamino]pentylamino]propyl]thiourea;dihydrochloride.
| Compound Name | 1-benzhydryl-3-[3-[5-[3-(benzhydrylcarbamothioylamino)propylamino]pentylamino]propyl]thiourea;dihydrochloride |
|---|---|
| PubChem CID | 127049225 |
| Molecular Formula | C39H52Cl2N6S2 |
| Molecular Weight | 739.93 g/mol |
| Exact Mass | 738.31 |
| IUPAC Name | 1-benzhydryl-3-[3-[5-[3-(benzhydrylcarbamothioylamino)propylamino]pentylamino]propyl]thiourea;dihydrochloride |
| SMILES | Cl.Cl.S=C(NCCCNCCCCCNCCCNC(=S)NC(c1ccccc1)c1ccccc1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H50N6S2.2ClH/c46-38(44-36(32-18-6-1-7-19-32)33-20-8-2-9-21-33)42-30-16-28-40-26-14-5-15-27-41-29-17-31-43-39(47)45-37(34-22-10-3-11-23-34)35-24-12-4-13-25-35;;/h1-4,6-13,18-25,36-37,40-41H,5,14-17,26-31H2,(H2,42,44,46)(H2,43,45,47);2*1H |
| InChIKey | YKODJCKHFROXHB-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.93 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|