C21H27FN2O3 — CID 166062751
methyl 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-3-fluorobenzoate (PubChem CID 166062751) has the molecular formula C21H27FN2O3 and a molecular weight of 374.46 g/mol. Its IUPAC name is methyl 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-3-fluorobenzoate.
| Compound Name | methyl 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-3-fluorobenzoate |
|---|---|
| PubChem CID | 166062751 |
| Molecular Formula | C21H27FN2O3 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | methyl 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)NC23CC4CC(C)(CC(C)(C4)C2)C3)c(F)c1 |
| InChI | InChI=1S/C21H27FN2O3/c1-19-7-13-8-20(2,10-19)12-21(9-13,11-19)24-18(26)23-16-5-4-14(6-15(16)22)17(25)27-3/h4-6,13H,7-12H2,1-3H3,(H2,23,24,26) |
| InChIKey | AFTYJYFYZLYPJY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |