C21H30N2O3S — CID 4009443
N-(1-adamantyl)-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide (PubChem CID 4009443) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is N-(1-adamantyl)-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide.
| Compound Name | N-(1-adamantyl)-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 4009443 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-(1-adamantyl)-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)NC23CC4CC(CC(C4)C2)C3)cc1C |
| InChI | InChI=1S/C21H30N2O3S/c1-14-3-4-19(7-15(14)2)27(25,26)22-6-5-20(24)23-21-11-16-8-17(12-21)10-18(9-16)13-21/h3-4,7,16-18,22H,5-6,8-13H2,1-2H3,(H,23,24) |
| InChIKey | QZEOPZIZNDXDHW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |