C20H26O3S — CID 136535958
1-(1-adamantyl)-2-(3,4-dimethylphenyl)sulfonylethanone (PubChem CID 136535958) has the molecular formula C20H26O3S and a molecular weight of 346.49 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-(3,4-dimethylphenyl)sulfonylethanone.
| Compound Name | 1-(1-adamantyl)-2-(3,4-dimethylphenyl)sulfonylethanone |
|---|---|
| PubChem CID | 136535958 |
| Molecular Formula | C20H26O3S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-(1-adamantyl)-2-(3,4-dimethylphenyl)sulfonylethanone |
| SMILES | Cc1ccc(S(=O)(=O)CC(=O)C23CC4CC(CC(C4)C2)C3)cc1C |
| InChI | InChI=1S/C20H26O3S/c1-13-3-4-18(5-14(13)2)24(22,23)12-19(21)20-9-15-6-16(10-20)8-17(7-15)11-20/h3-5,15-17H,6-12H2,1-2H3 |
| InChIKey | BOVVECADJGFSIS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |