C25H30N2O3S — CID 43008919
N-(1-adamantyl)-5-(benzylsulfamoyl)-2-methylbenzamide (PubChem CID 43008919) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is N-(1-adamantyl)-5-(benzylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-(1-adamantyl)-5-(benzylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 43008919 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-(1-adamantyl)-5-(benzylsulfamoyl)-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccccc2)cc1C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H30N2O3S/c1-17-7-8-22(31(29,30)26-16-18-5-3-2-4-6-18)12-23(17)24(28)27-25-13-19-9-20(14-25)11-21(10-19)15-25/h2-8,12,19-21,26H,9-11,13-16H2,1H3,(H,27,28) |
| InChIKey | XBFADWCUJMIDHZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |