C17H17F3N2O3S — CID 51166535
5-(benzylsulfamoyl)-2-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 51166535) has the molecular formula C17H17F3N2O3S and a molecular weight of 386.40 g/mol. Its IUPAC name is 5-(benzylsulfamoyl)-2-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 5-(benzylsulfamoyl)-2-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 51166535 |
| Molecular Formula | C17H17F3N2O3S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 5-(benzylsulfamoyl)-2-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccccc2)cc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O3S/c1-12-7-8-14(9-15(12)16(23)21-11-17(18,19)20)26(24,25)22-10-13-5-3-2-4-6-13/h2-9,22H,10-11H2,1H3,(H,21,23) |
| InChIKey | YEXUHVFLVWEBNO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |