C28H32F5N5O5 — CID 175485200
1-[3-fluoro-4-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]benzoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]piperidine-3-carboxamide (PubChem CID 175485200) has the molecular formula C28H32F5N5O5 and a molecular weight of 613.58 g/mol. Its IUPAC name is 1-[3-fluoro-4-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]benzoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-fluoro-4-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]benzoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 175485200 |
| Molecular Formula | C28H32F5N5O5 |
| Molecular Weight | 613.58 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | 1-[3-fluoro-4-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]benzoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]piperidine-3-carboxamide |
| SMILES | O=C(CCCCCCNC(=O)C1CCCN(C(=O)c2ccc(NC(=O)Nc3ccc(F)c(C(F)(F)F)c3)c(F)c2)C1)NO |
| InChI | InChI=1S/C28H32F5N5O5/c29-21-10-9-19(15-20(21)28(31,32)33)35-27(42)36-23-11-8-17(14-22(23)30)26(41)38-13-5-6-18(16-38)25(40)34-12-4-2-1-3-7-24(39)37-43/h8-11,14-15,18,43H,1-7,12-13,16H2,(H,34,40)(H,37,39)(H2,35,36,42) |
| InChIKey | GWFUXJMCLBAUOH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|