C28H35F2N5O5 — CID 175485168
1-[3-fluoro-4-[(3-fluoro-4-methylphenyl)carbamoylamino]benzoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]piperidine-3-carboxamide (PubChem CID 175485168) has the molecular formula C28H35F2N5O5 and a molecular weight of 559.61 g/mol. Its IUPAC name is 1-[3-fluoro-4-[(3-fluoro-4-methylphenyl)carbamoylamino]benzoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-fluoro-4-[(3-fluoro-4-methylphenyl)carbamoylamino]benzoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 175485168 |
| Molecular Formula | C28H35F2N5O5 |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | 1-[3-fluoro-4-[(3-fluoro-4-methylphenyl)carbamoylamino]benzoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(C(=O)N3CCCC(C(=O)NCCCCCCC(=O)NO)C3)cc2F)cc1F |
| InChI | InChI=1S/C28H35F2N5O5/c1-18-9-11-21(16-22(18)29)32-28(39)33-24-12-10-19(15-23(24)30)27(38)35-14-6-7-20(17-35)26(37)31-13-5-3-2-4-8-25(36)34-40/h9-12,15-16,20,40H,2-8,13-14,17H2,1H3,(H,31,37)(H,34,36)(H2,32,33,39) |
| InChIKey | GTHFPIDQFVLOOY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|