C22H23BrFN3O3 — CID 55951069
N-[3-(4-bromoanilino)-3-oxopropyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide (PubChem CID 55951069) has the molecular formula C22H23BrFN3O3 and a molecular weight of 476.35 g/mol. Its IUPAC name is N-[3-(4-bromoanilino)-3-oxopropyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-[3-(4-bromoanilino)-3-oxopropyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55951069 |
| Molecular Formula | C22H23BrFN3O3 |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[3-(4-bromoanilino)-3-oxopropyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide |
| SMILES | O=C(CCNC(=O)C1CCCN(C(=O)c2ccc(F)cc2)C1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H23BrFN3O3/c23-17-5-9-19(10-6-17)26-20(28)11-12-25-21(29)16-2-1-13-27(14-16)22(30)15-3-7-18(24)8-4-15/h3-10,16H,1-2,11-14H2,(H,25,29)(H,26,28) |
| InChIKey | DZJWWJJOLZWSJI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |