C21H23FN2O2S — CID 51272724
1-(4-fluorobenzoyl)-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide (PubChem CID 51272724) has the molecular formula C21H23FN2O2S and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51272724 |
| Molecular Formula | C21H23FN2O2S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCSc1ccccc1)C1CCCN(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H23FN2O2S/c22-18-10-8-16(9-11-18)21(26)24-13-4-5-17(15-24)20(25)23-12-14-27-19-6-2-1-3-7-19/h1-3,6-11,17H,4-5,12-15H2,(H,23,25) |
| InChIKey | JWFSXXXZVZZIFO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|