C22H25FN2O3 — CID 134023186
1-(4-fluorobenzoyl)-N-[[2-(methoxymethyl)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 134023186) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-[[2-(methoxymethyl)phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-[[2-(methoxymethyl)phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 134023186 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-[[2-(methoxymethyl)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | COCc1ccccc1CNC(=O)C1CCCN(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H25FN2O3/c1-28-15-19-6-3-2-5-17(19)13-24-21(26)18-7-4-12-25(14-18)22(27)16-8-10-20(23)11-9-16/h2-3,5-6,8-11,18H,4,7,12-15H2,1H3,(H,24,26) |
| InChIKey | XAHMZYTZACNPTE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |