C12H16ClN3O2 — CID 125169589
1-(3-chlorophenyl)-3-[[(3R)-3-hydroxypyrrolidin-3-yl]methyl]urea (PubChem CID 125169589) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[(3R)-3-hydroxypyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[[(3R)-3-hydroxypyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 125169589 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[(3R)-3-hydroxypyrrolidin-3-yl]methyl]urea |
| SMILES | O=C(NC[C@@]1(O)CCNC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H16ClN3O2/c13-9-2-1-3-10(6-9)16-11(17)15-8-12(18)4-5-14-7-12/h1-3,6,14,18H,4-5,7-8H2,(H2,15,16,17)/t12-/m1/s1 |
| InChIKey | UGPHRIVEVLHEKL-GFCCVEGCSA-N |
| XLogP | 1.19 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |