C16H25N3O3 — CID 118785673
1-(3-butoxyphenyl)-3-[(3-hydroxypyrrolidin-3-yl)methyl]urea (PubChem CID 118785673) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-(3-butoxyphenyl)-3-[(3-hydroxypyrrolidin-3-yl)methyl]urea.
| Compound Name | 1-(3-butoxyphenyl)-3-[(3-hydroxypyrrolidin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 118785673 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 1-(3-butoxyphenyl)-3-[(3-hydroxypyrrolidin-3-yl)methyl]urea |
| SMILES | CCCCOc1cccc(NC(=O)NCC2(O)CCNC2)c1 |
| InChI | InChI=1S/C16H25N3O3/c1-2-3-9-22-14-6-4-5-13(10-14)19-15(20)18-12-16(21)7-8-17-11-16/h4-6,10,17,21H,2-3,7-9,11-12H2,1H3,(H2,18,19,20) |
| InChIKey | ZKPXCSNXUQUPMK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|