C13H18ClN3O3 — CID 125169385
1-(3-chloro-4-methoxyphenyl)-3-[[(3R)-3-hydroxypyrrolidin-3-yl]methyl]urea (PubChem CID 125169385) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[[(3R)-3-hydroxypyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[[(3R)-3-hydroxypyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 125169385 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[[(3R)-3-hydroxypyrrolidin-3-yl]methyl]urea |
| SMILES | COc1ccc(NC(=O)NC[C@@]2(O)CCNC2)cc1Cl |
| InChI | InChI=1S/C13H18ClN3O3/c1-20-11-3-2-9(6-10(11)14)17-12(18)16-8-13(19)4-5-15-7-13/h2-3,6,15,19H,4-5,7-8H2,1H3,(H2,16,17,18)/t13-/m1/s1 |
| InChIKey | VPRZQAHPZJMUKG-CYBMUJFWSA-N |
| XLogP | 1.19 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |