C18H22N4O4 — CID 125162716
1-[[(3S)-3-hydroxypyrrolidin-3-yl]methyl]-3-[6-(2-methoxyphenoxy)-3-pyridinyl]urea (PubChem CID 125162716) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-[[(3S)-3-hydroxypyrrolidin-3-yl]methyl]-3-[6-(2-methoxyphenoxy)-3-pyridinyl]urea.
| Compound Name | 1-[[(3S)-3-hydroxypyrrolidin-3-yl]methyl]-3-[6-(2-methoxyphenoxy)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 125162716 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-[[(3S)-3-hydroxypyrrolidin-3-yl]methyl]-3-[6-(2-methoxyphenoxy)-3-pyridinyl]urea |
| SMILES | COc1ccccc1Oc1ccc(NC(=O)NC[C@]2(O)CCNC2)cn1 |
| InChI | InChI=1S/C18H22N4O4/c1-25-14-4-2-3-5-15(14)26-16-7-6-13(10-20-16)22-17(23)21-12-18(24)8-9-19-11-18/h2-7,10,19,24H,8-9,11-12H2,1H3,(H2,21,22,23)/t18-/m0/s1 |
| InChIKey | QIQVDCWAXDBEJV-SFHVURJKSA-N |
| XLogP | 1.73 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |