C20H25N3O4 — CID 118763888
1-[6-(2-methoxyphenoxy)-3-pyridinyl]-3-[2-(oxan-3-yl)ethyl]urea (PubChem CID 118763888) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[6-(2-methoxyphenoxy)-3-pyridinyl]-3-[2-(oxan-3-yl)ethyl]urea.
| Compound Name | 1-[6-(2-methoxyphenoxy)-3-pyridinyl]-3-[2-(oxan-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 118763888 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[6-(2-methoxyphenoxy)-3-pyridinyl]-3-[2-(oxan-3-yl)ethyl]urea |
| SMILES | COc1ccccc1Oc1ccc(NC(=O)NCCC2CCCOC2)cn1 |
| InChI | InChI=1S/C20H25N3O4/c1-25-17-6-2-3-7-18(17)27-19-9-8-16(13-22-19)23-20(24)21-11-10-15-5-4-12-26-14-15/h2-3,6-9,13,15H,4-5,10-12,14H2,1H3,(H2,21,23,24) |
| InChIKey | REZSZYBJTNZKKG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |