C21H27N3O5 — CID 163341520
acetic acid;N-[6-(2-methoxyphenoxy)-3-pyridinyl]-1-methylpiperidine-3-carboxamide (PubChem CID 163341520) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is acetic acid;N-[6-(2-methoxyphenoxy)-3-pyridinyl]-1-methylpiperidine-3-carboxamide.
| Compound Name | acetic acid;N-[6-(2-methoxyphenoxy)-3-pyridinyl]-1-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 163341520 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | acetic acid;N-[6-(2-methoxyphenoxy)-3-pyridinyl]-1-methylpiperidine-3-carboxamide |
| SMILES | CC(=O)O.COc1ccccc1Oc1ccc(NC(=O)C2CCCN(C)C2)cn1 |
| InChI | InChI=1S/C19H23N3O3.C2H4O2/c1-22-11-5-6-14(13-22)19(23)21-15-9-10-18(20-12-15)25-17-8-4-3-7-16(17)24-2;1-2(3)4/h3-4,7-10,12,14H,5-6,11,13H2,1-2H3,(H,21,23);1H3,(H,3,4) |
| InChIKey | BVMIGWBFXJSNLV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |