C23H22ClN3O3 — CID 97000078
(3S)-N-(6-chloro-3-pyridinyl)-1-(4-methoxynaphthalene-1-carbonyl)piperidine-3-carboxamide (PubChem CID 97000078) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is (3S)-N-(6-chloro-3-pyridinyl)-1-(4-methoxynaphthalene-1-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(6-chloro-3-pyridinyl)-1-(4-methoxynaphthalene-1-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97000078 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | (3S)-N-(6-chloro-3-pyridinyl)-1-(4-methoxynaphthalene-1-carbonyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCC[C@H](C(=O)Nc3ccc(Cl)nc3)C2)c2ccccc12 |
| InChI | InChI=1S/C23H22ClN3O3/c1-30-20-10-9-19(17-6-2-3-7-18(17)20)23(29)27-12-4-5-15(14-27)22(28)26-16-8-11-21(24)25-13-16/h2-3,6-11,13,15H,4-5,12,14H2,1H3,(H,26,28)/t15-/m0/s1 |
| InChIKey | BMPYHGOKTWITKZ-HNNXBMFYSA-N |
| XLogP | 4.39 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|