C19H29N5O3 — CID 74248365
1-[(3-hydroxypiperidin-3-yl)methyl]-3-[3-(4-methylpiperazine-1-carbonyl)phenyl]urea (PubChem CID 74248365) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[(3-hydroxypiperidin-3-yl)methyl]-3-[3-(4-methylpiperazine-1-carbonyl)phenyl]urea.
| Compound Name | 1-[(3-hydroxypiperidin-3-yl)methyl]-3-[3-(4-methylpiperazine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 74248365 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-[(3-hydroxypiperidin-3-yl)methyl]-3-[3-(4-methylpiperazine-1-carbonyl)phenyl]urea |
| SMILES | CN1CCN(C(=O)c2cccc(NC(=O)NCC3(O)CCCNC3)c2)CC1 |
| InChI | InChI=1S/C19H29N5O3/c1-23-8-10-24(11-9-23)17(25)15-4-2-5-16(12-15)22-18(26)21-14-19(27)6-3-7-20-13-19/h2,4-5,12,20,27H,3,6-11,13-14H2,1H3,(H2,21,22,26) |
| InChIKey | WKCPAEUKVLWLFK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |