C11H13Cl2N3O2 — CID 114189607
1-(2,5-dichlorophenyl)-3-[(3-hydroxyazetidin-3-yl)methyl]urea (PubChem CID 114189607) has the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[(3-hydroxyazetidin-3-yl)methyl]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[(3-hydroxyazetidin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 114189607 |
| Molecular Formula | C11H13Cl2N3O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[(3-hydroxyazetidin-3-yl)methyl]urea |
| SMILES | O=C(NCC1(O)CNC1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H13Cl2N3O2/c12-7-1-2-8(13)9(3-7)16-10(17)15-6-11(18)4-14-5-11/h1-3,14,18H,4-6H2,(H2,15,16,17) |
| InChIKey | KBYXSRDNKRUFTF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |