C11H12Cl2N2O2 — CID 114189535
2,4-dichloro-N-[(3-hydroxyazetidin-3-yl)methyl]benzamide (PubChem CID 114189535) has the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.13 g/mol. Its IUPAC name is 2,4-dichloro-N-[(3-hydroxyazetidin-3-yl)methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(3-hydroxyazetidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 114189535 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 2,4-dichloro-N-[(3-hydroxyazetidin-3-yl)methyl]benzamide |
| SMILES | O=C(NCC1(O)CNC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O2/c12-7-1-2-8(9(13)3-7)10(16)15-6-11(17)4-14-5-11/h1-3,14,17H,4-6H2,(H,15,16) |
| InChIKey | OACYXTNUKCEPNY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |