C16H19Cl2NO — CID 143467111
2,4-dichloro-N-[[1-(cyclopropylmethyl)cyclobutyl]methyl]benzamide (PubChem CID 143467111) has the molecular formula C16H19Cl2NO and a molecular weight of 312.24 g/mol. Its IUPAC name is 2,4-dichloro-N-[[1-(cyclopropylmethyl)cyclobutyl]methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[1-(cyclopropylmethyl)cyclobutyl]methyl]benzamide |
|---|---|
| PubChem CID | 143467111 |
| Molecular Formula | C16H19Cl2NO |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2,4-dichloro-N-[[1-(cyclopropylmethyl)cyclobutyl]methyl]benzamide |
| SMILES | O=C(NCC1(CC2CC2)CCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl2NO/c17-12-4-5-13(14(18)8-12)15(20)19-10-16(6-1-7-16)9-11-2-3-11/h4-5,8,11H,1-3,6-7,9-10H2,(H,19,20) |
| InChIKey | KHPRJVZYLXGJKB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |