C24H37ClN2O2 — CID 143210765
2-chloro-N-[[4-(cyclopropylmethyl)-1-methylpiperidin-4-yl]methyl]-4-methylbenzamide;ethynol;propane (PubChem CID 143210765) has the molecular formula C24H37ClN2O2 and a molecular weight of 421.03 g/mol. Its IUPAC name is 2-chloro-N-[[4-(cyclopropylmethyl)-1-methylpiperidin-4-yl]methyl]-4-methylbenzamide;ethynol;propane.
| Compound Name | 2-chloro-N-[[4-(cyclopropylmethyl)-1-methylpiperidin-4-yl]methyl]-4-methylbenzamide;ethynol;propane |
|---|---|
| PubChem CID | 143210765 |
| Molecular Formula | C24H37ClN2O2 |
| Molecular Weight | 421.03 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 2-chloro-N-[[4-(cyclopropylmethyl)-1-methylpiperidin-4-yl]methyl]-4-methylbenzamide;ethynol;propane |
| SMILES | C#CO.CCC.Cc1ccc(C(=O)NCC2(CC3CC3)CCN(C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C19H27ClN2O.C3H8.C2H2O/c1-14-3-6-16(17(20)11-14)18(23)21-13-19(12-15-4-5-15)7-9-22(2)10-8-19;1-3-2;1-2-3/h3,6,11,15H,4-5,7-10,12-13H2,1-2H3,(H,21,23);3H2,1-2H3;1,3H |
| InChIKey | NFRKRZWWXAJBSB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.03 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|