C16H21ClN2O — CID 99832914
2-chloro-N-[[(3R)-1-cyclopropylpyrrolidin-3-yl]methyl]-4-methylbenzamide (PubChem CID 99832914) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-chloro-N-[[(3R)-1-cyclopropylpyrrolidin-3-yl]methyl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[[(3R)-1-cyclopropylpyrrolidin-3-yl]methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 99832914 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-chloro-N-[[(3R)-1-cyclopropylpyrrolidin-3-yl]methyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC[C@H]2CCN(C3CC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClN2O/c1-11-2-5-14(15(17)8-11)16(20)18-9-12-6-7-19(10-12)13-3-4-13/h2,5,8,12-13H,3-4,6-7,9-10H2,1H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | CUSXYZKLIMFNIR-GFCCVEGCSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |