C15H20ClNO2 — CID 106124243
2-chloro-N-[(4-hydroxycyclohexyl)methyl]-4-methylbenzamide (PubChem CID 106124243) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 2-chloro-N-[(4-hydroxycyclohexyl)methyl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(4-hydroxycyclohexyl)methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 106124243 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-chloro-N-[(4-hydroxycyclohexyl)methyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC2CCC(O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClNO2/c1-10-2-7-13(14(16)8-10)15(19)17-9-11-3-5-12(18)6-4-11/h2,7-8,11-12,18H,3-6,9H2,1H3,(H,17,19) |
| InChIKey | BHNBERZHYUSXPW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |