C12H15ClF3N3O2 — CID 154903222
1-[(3-hydroxypyrrolidin-3-yl)methyl]-3-(2,4,5-trifluorophenyl)urea;hydrochloride (PubChem CID 154903222) has the molecular formula C12H15ClF3N3O2 and a molecular weight of 325.72 g/mol. Its IUPAC name is 1-[(3-hydroxypyrrolidin-3-yl)methyl]-3-(2,4,5-trifluorophenyl)urea;hydrochloride.
| Compound Name | 1-[(3-hydroxypyrrolidin-3-yl)methyl]-3-(2,4,5-trifluorophenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 154903222 |
| Molecular Formula | C12H15ClF3N3O2 |
| Molecular Weight | 325.72 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 1-[(3-hydroxypyrrolidin-3-yl)methyl]-3-(2,4,5-trifluorophenyl)urea;hydrochloride |
| SMILES | Cl.O=C(NCC1(O)CCNC1)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H14F3N3O2.ClH/c13-7-3-9(15)10(4-8(7)14)18-11(19)17-6-12(20)1-2-16-5-12;/h3-4,16,20H,1-2,5-6H2,(H2,17,18,19);1H |
| InChIKey | INCYUZKJDNTJGY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.72 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|