C12H11F5N2O2 — CID 114760608
2,3,4,5,6-pentafluoro-N-[(3-hydroxypyrrolidin-3-yl)methyl]benzamide (PubChem CID 114760608) has the molecular formula C12H11F5N2O2 and a molecular weight of 310.22 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(3-hydroxypyrrolidin-3-yl)methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(3-hydroxypyrrolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 114760608 |
| Molecular Formula | C12H11F5N2O2 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(3-hydroxypyrrolidin-3-yl)methyl]benzamide |
| SMILES | O=C(NCC1(O)CCNC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H11F5N2O2/c13-6-5(7(14)9(16)10(17)8(6)15)11(20)19-4-12(21)1-2-18-3-12/h18,21H,1-4H2,(H,19,20) |
| InChIKey | ALXSQWZHGDABFQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|