C11H11F3N2O2 — CID 114189501
3,4,5-trifluoro-N-[(3-hydroxyazetidin-3-yl)methyl]benzamide (PubChem CID 114189501) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[(3-hydroxyazetidin-3-yl)methyl]benzamide.
| Compound Name | 3,4,5-trifluoro-N-[(3-hydroxyazetidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 114189501 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3,4,5-trifluoro-N-[(3-hydroxyazetidin-3-yl)methyl]benzamide |
| SMILES | O=C(NCC1(O)CNC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H11F3N2O2/c12-7-1-6(2-8(13)9(7)14)10(17)16-5-11(18)3-15-4-11/h1-2,15,18H,3-5H2,(H,16,17) |
| InChIKey | RBAWYZZHHWAREY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|