C15H16F6N2O2 — CID 77088762
N-[(3-hydroxypiperidin-3-yl)methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 77088762) has the molecular formula C15H16F6N2O2 and a molecular weight of 370.29 g/mol. Its IUPAC name is N-[(3-hydroxypiperidin-3-yl)methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(3-hydroxypiperidin-3-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 77088762 |
| Molecular Formula | C15H16F6N2O2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[(3-hydroxypiperidin-3-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1(O)CCCNC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F6N2O2/c16-14(17,18)10-4-9(5-11(6-10)15(19,20)21)12(24)23-8-13(25)2-1-3-22-7-13/h4-6,22,25H,1-3,7-8H2,(H,23,24) |
| InChIKey | ZWQWHVATYKBAAT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |