C20H22F2N2O3 — CID 125448120
4-[4-(difluoromethoxy)phenyl]-N-[[(3R)-3-hydroxypiperidin-3-yl]methyl]benzamide (PubChem CID 125448120) has the molecular formula C20H22F2N2O3 and a molecular weight of 376.40 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-N-[[(3R)-3-hydroxypiperidin-3-yl]methyl]benzamide.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-N-[[(3R)-3-hydroxypiperidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 125448120 |
| Molecular Formula | C20H22F2N2O3 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-N-[[(3R)-3-hydroxypiperidin-3-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@]1(O)CCCNC1)c1ccc(-c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H22F2N2O3/c21-19(22)27-17-8-6-15(7-9-17)14-2-4-16(5-3-14)18(25)24-13-20(26)10-1-11-23-12-20/h2-9,19,23,26H,1,10-13H2,(H,24,25)/t20-/m1/s1 |
| InChIKey | BNXOXZTTXFJFOY-HXUWFJFHSA-N |
| XLogP | 2.80 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |